About 1-ethenyl-3,5-dimethylpiperidine
1-ethenyl-3,5-dimethylpiperidine (PubChem CID 89325072) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 1-ethenyl-3,5-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-ethenyl-3,5-dimethylpiperidine |
| PubChem CID | 89325072 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 1-ethenyl-3,5-dimethylpiperidine |
| SMILES | C=CN1CC(C)CC(C)C1 |
| InChI | InChI=1S/C9H17N/c1-4-10-6-8(2)5-9(3)7-10/h4,8-9H,1,5-7H2,2-3H3 |
| InChIKey | OSESKEPWDKQZAQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethenyl-3,5-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-3,5-dimethylpiperidine?
The IUPAC name of 1-ethenyl-3,5-dimethylpiperidine (CID 89325072) is 1-ethenyl-3,5-dimethylpiperidine.
What is the SMILES notation for 1-ethenyl-3,5-dimethylpiperidine?
The canonical SMILES for 1-ethenyl-3,5-dimethylpiperidine is C=CN1CC(C)CC(C)C1.
What is the InChIKey of 1-ethenyl-3,5-dimethylpiperidine?
The InChIKey is OSESKEPWDKQZAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-4-10-6-8(2)5-9(3)7-10/h4,8-9H,1,5-7H2,2-3H3.
What are the key properties of 1-ethenyl-3,5-dimethylpiperidine?
1-ethenyl-3,5-dimethylpiperidine has a molecular weight of 139.24 g/mol, XLogP of 2.11, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-3,5-dimethylpiperidine is sourced from PubChem (CID 89325072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).