About 2-(3,4-dichlorophenyl)-4-(C,N-dimethylcarbonimidoyl)thiophen-3-ol
2-(3,4-dichlorophenyl)-4-(C,N-dimethylcarbonimidoyl)thiophen-3-ol (PubChem CID 89325135) has the molecular formula C13H11Cl2NOS
and a molecular weight of 300.21 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-4-(C,N-dimethylcarbonimidoyl)thiophen-3-ol.
Molecular Properties
| Compound Name | 2-(3,4-dichlorophenyl)-4-(C,N-dimethylcarbonimidoyl)thiophen-3-ol |
| PubChem CID | 89325135 |
| Molecular Formula | C13H11Cl2NOS |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-4-(C,N-dimethylcarbonimidoyl)thiophen-3-ol |
| SMILES | C/N=C(\C)c1csc(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C13H11Cl2NOS/c1-7(16-2)9-6-18-13(12(9)17)8-3-4-10(14)11(15)5-8/h3-6,17H,1-2H3/b16-7+ |
| InChIKey | ZIWAPIQIYQQSDY-FRKPEAEDSA-N |
| XLogP | 4.87 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dichlorophenyl)-4-(C,N-dimethylcarbonimidoyl)thiophen-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dichlorophenyl)-4-(C,N-dimethylcarbonimidoyl)thiophen-3-ol?
The IUPAC name of 2-(3,4-dichlorophenyl)-4-(C,N-dimethylcarbonimidoyl)thiophen-3-ol (CID 89325135) is 2-(3,4-dichlorophenyl)-4-(C,N-dimethylcarbonimidoyl)thiophen-3-ol.
What is the SMILES notation for 2-(3,4-dichlorophenyl)-4-(C,N-dimethylcarbonimidoyl)thiophen-3-ol?
The canonical SMILES for 2-(3,4-dichlorophenyl)-4-(C,N-dimethylcarbonimidoyl)thiophen-3-ol is C/N=C(\C)c1csc(-c2ccc(Cl)c(Cl)c2)c1O.
What is the InChIKey of 2-(3,4-dichlorophenyl)-4-(C,N-dimethylcarbonimidoyl)thiophen-3-ol?
The InChIKey is ZIWAPIQIYQQSDY-FRKPEAEDSA-N. The full InChI is InChI=1S/C13H11Cl2NOS/c1-7(16-2)9-6-18-13(12(9)17)8-3-4-10(14)11(15)5-8/h3-6,17H,1-2H3/b16-7+.
What are the key properties of 2-(3,4-dichlorophenyl)-4-(C,N-dimethylcarbonimidoyl)thiophen-3-ol?
2-(3,4-dichlorophenyl)-4-(C,N-dimethylcarbonimidoyl)thiophen-3-ol has a molecular weight of 300.21 g/mol, XLogP of 4.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dichlorophenyl)-4-(C,N-dimethylcarbonimidoyl)thiophen-3-ol is sourced from PubChem (CID 89325135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).