C8H6F6O3S — CID 89325197
(5R)-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonic acid (PubChem CID 89325197) has the molecular formula C8H6F6O3S and a molecular weight of 296.19 g/mol. Its IUPAC name is (5R)-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonic acid.
| Compound Name | (5R)-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 89325197 |
| Molecular Formula | C8H6F6O3S |
| Molecular Weight | 296.19 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | (5R)-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonic acid |
| SMILES | O=S(=O)(O)C1=CC(C(F)(F)F)=C[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C8H6F6O3S/c9-7(10,11)4-1-5(8(12,13)14)3-6(2-4)18(15,16)17/h1-2,5H,3H2,(H,15,16,17)/t5-/m0/s1 |
| InChIKey | PQDMWZGUOHCQKS-YFKPBYRVSA-N |
| XLogP | 2.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.19 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|