About CID 89325272
CID 89325272 (PubChem CID 89325272) has the molecular formula C25H28N7O2S-
and a molecular weight of 490.61 g/mol.
Molecular Properties
| Compound Name | CID 89325272 |
| PubChem CID | 89325272 |
| Molecular Formula | C25H28N7O2S- |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | — |
| SMILES | [H]/N=[S-](=O)/c1cccc(Nc2ncc(-c3ccc(OCC)cc3)c(NCCCc3cn[nH]c3C)n2)c1 |
| InChI | InChI=1S/C25H28N7O2S/c1-3-34-21-11-9-18(10-12-21)23-16-28-25(30-20-7-4-8-22(14-20)35(26)33)31-24(23)27-13-5-6-19-15-29-32-17(19)2/h4,7-12,14-16,26H,3,5-6,13H2,1-2H3,(H,29,32)(H2,27,28,30,31)/q-1 |
| InChIKey | KOIXMQSYBFNBAP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 89325272 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89325272?
The IUPAC name of CID 89325272 (CID 89325272) is not available.
What is the SMILES notation for CID 89325272?
The canonical SMILES for CID 89325272 is [H]/N=[S-](=O)/c1cccc(Nc2ncc(-c3ccc(OCC)cc3)c(NCCCc3cn[nH]c3C)n2)c1.
What is the InChIKey of CID 89325272?
The InChIKey is KOIXMQSYBFNBAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N7O2S/c1-3-34-21-11-9-18(10-12-21)23-16-28-25(30-20-7-4-8-22(14-20)35(26)33)31-24(23)27-13-5-6-19-15-29-32-17(19)2/h4,7-12,14-16,26H,3,5-6,13H2,1-2H3,(H,29,32)(H2,27,28,30,31)/q-1.
What are the key properties of CID 89325272?
CID 89325272 has a molecular weight of 490.61 g/mol, XLogP of 5.45, 11 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89325272 is sourced from PubChem (CID 89325272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).