About (1E,3E)-1-cyano-4-piperidin-1-ylbuta-1,3-diene-1-sulfinic acid
(1E,3E)-1-cyano-4-piperidin-1-ylbuta-1,3-diene-1-sulfinic acid (PubChem CID 89325349) has the molecular formula C10H14N2O2S
and a molecular weight of 226.30 g/mol. Its IUPAC name is (1E,3E)-1-cyano-4-piperidin-1-ylbuta-1,3-diene-1-sulfinic acid.
Molecular Properties
| Compound Name | (1E,3E)-1-cyano-4-piperidin-1-ylbuta-1,3-diene-1-sulfinic acid |
| PubChem CID | 89325349 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (1E,3E)-1-cyano-4-piperidin-1-ylbuta-1,3-diene-1-sulfinic acid |
| SMILES | N#C/C(=C\C=C\N1CCCCC1)S(=O)O |
| InChI | InChI=1S/C10H14N2O2S/c11-9-10(15(13)14)5-4-8-12-6-2-1-3-7-12/h4-5,8H,1-3,6-7H2,(H,13,14)/b8-4+,10-5+ |
| InChIKey | OLOXNVRAUVJSNZ-DXNUHORPSA-N |
| XLogP | 1.62 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (1E,3E)-1-cyano-4-piperidin-1-ylbuta-1,3-diene-1-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3E)-1-cyano-4-piperidin-1-ylbuta-1,3-diene-1-sulfinic acid?
The IUPAC name of (1E,3E)-1-cyano-4-piperidin-1-ylbuta-1,3-diene-1-sulfinic acid (CID 89325349) is (1E,3E)-1-cyano-4-piperidin-1-ylbuta-1,3-diene-1-sulfinic acid.
What is the SMILES notation for (1E,3E)-1-cyano-4-piperidin-1-ylbuta-1,3-diene-1-sulfinic acid?
The canonical SMILES for (1E,3E)-1-cyano-4-piperidin-1-ylbuta-1,3-diene-1-sulfinic acid is N#C/C(=C\C=C\N1CCCCC1)S(=O)O.
What is the InChIKey of (1E,3E)-1-cyano-4-piperidin-1-ylbuta-1,3-diene-1-sulfinic acid?
The InChIKey is OLOXNVRAUVJSNZ-DXNUHORPSA-N. The full InChI is InChI=1S/C10H14N2O2S/c11-9-10(15(13)14)5-4-8-12-6-2-1-3-7-12/h4-5,8H,1-3,6-7H2,(H,13,14)/b8-4+,10-5+.
What are the key properties of (1E,3E)-1-cyano-4-piperidin-1-ylbuta-1,3-diene-1-sulfinic acid?
(1E,3E)-1-cyano-4-piperidin-1-ylbuta-1,3-diene-1-sulfinic acid has a molecular weight of 226.30 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3E)-1-cyano-4-piperidin-1-ylbuta-1,3-diene-1-sulfinic acid is sourced from PubChem (CID 89325349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).