C36H57NO10 — CID 89325444
[(3E,5E)-6-[(4E)-6-acetyloxy-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-2-methylhepta-3,5-dienyl] pyrrolidine-1-carboxylate (PubChem CID 89325444) has the molecular formula C36H57NO10 and a molecular weight of 663.85 g/mol. Its IUPAC name is [(3E,5E)-6-[(4E)-6-acetyloxy-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-2-methylhepta-3,5-dienyl] pyrrolidine-1-carboxylate.
| Compound Name | [(3E,5E)-6-[(4E)-6-acetyloxy-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-2-methylhepta-3,5-dienyl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 89325444 |
| Molecular Formula | C36H57NO10 |
| Molecular Weight | 663.85 g/mol |
| Exact Mass | 663.40 |
| IUPAC Name | [(3E,5E)-6-[(4E)-6-acetyloxy-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-2-methylhepta-3,5-dienyl] pyrrolidine-1-carboxylate |
| SMILES | CCC(OC)C(C)C1OC1C(OC(=O)N1CCCC1)C(C)/C=C/C=C(\C)C1OC(=O)CC(O)CCC(C)(O)C(OC(C)=O)/C=C/C1C |
| InChI | InChI=1S/C36H57NO10/c1-9-28(43-8)25(5)33-34(46-33)32(47-35(41)37-19-10-11-20-37)23(3)14-12-13-22(2)31-24(4)15-16-29(44-26(6)38)36(7,42)18-17-27(39)21-30(40)45-31/h12-16,23-25,27-29,31-34,39,42H,9-11,17-21H2,1-8H3/b14-12+,16-15+,22-13+ |
| InChIKey | XGZLENKQOMTVSQ-YRYBQFCWSA-N |
| XLogP | 4.89 |
| TPSA | 144.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.85 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|