C10H16N4 — CID 89326013
5,6-diimino-1-N,1-N,3-N,3-N-tetramethylcyclohexa-1,3-diene-1,3-diamine (PubChem CID 89326013) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 5,6-diimino-1-N,1-N,3-N,3-N-tetramethylcyclohexa-1,3-diene-1,3-diamine.
| Compound Name | 5,6-diimino-1-N,1-N,3-N,3-N-tetramethylcyclohexa-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 89326013 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 5,6-diimino-1-N,1-N,3-N,3-N-tetramethylcyclohexa-1,3-diene-1,3-diamine |
| SMILES | [H]/N=C1/C(N(C)C)=CC(N(C)C)=C/C1=N\[H] |
| InChI | InChI=1S/C10H16N4/c1-13(2)7-5-8(11)10(12)9(6-7)14(3)4/h5-6,11-12H,1-4H3/b11-8+,12-10+ |
| InChIKey | QDVQGLJYULWDIN-TXSAMIJNSA-N |
| XLogP | 0.93 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|