C15H16BrF3O — CID 89326163
1-bromo-2-methyl-5-[(1E,3E,5Z)-3-(trifluoromethyl)hepta-1,3,5-trienoxy]cyclohexa-1,3-diene (PubChem CID 89326163) has the molecular formula C15H16BrF3O and a molecular weight of 349.19 g/mol. Its IUPAC name is 1-bromo-2-methyl-5-[(1E,3E,5Z)-3-(trifluoromethyl)hepta-1,3,5-trienoxy]cyclohexa-1,3-diene.
| Compound Name | 1-bromo-2-methyl-5-[(1E,3E,5Z)-3-(trifluoromethyl)hepta-1,3,5-trienoxy]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 89326163 |
| Molecular Formula | C15H16BrF3O |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 1-bromo-2-methyl-5-[(1E,3E,5Z)-3-(trifluoromethyl)hepta-1,3,5-trienoxy]cyclohexa-1,3-diene |
| SMILES | C/C=C\C=C(/C=C/OC1C=CC(C)=C(Br)C1)C(F)(F)F |
| InChI | InChI=1S/C15H16BrF3O/c1-3-4-5-12(15(17,18)19)8-9-20-13-7-6-11(2)14(16)10-13/h3-9,13H,10H2,1-2H3/b4-3-,9-8+,12-5+ |
| InChIKey | OCLASWLPWAKCIY-DLCYRIAOSA-N |
| XLogP | 5.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|