C11H19N — CID 89326170
2-ethyl-2,3,4,4a,5,6,7,8-octahydroquinoline (PubChem CID 89326170) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 2-ethyl-2,3,4,4a,5,6,7,8-octahydroquinoline.
| Compound Name | 2-ethyl-2,3,4,4a,5,6,7,8-octahydroquinoline |
|---|---|
| PubChem CID | 89326170 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 2-ethyl-2,3,4,4a,5,6,7,8-octahydroquinoline |
| SMILES | CCC1CCC2CCCCC2=N1 |
| InChI | InChI=1S/C11H19N/c1-2-10-8-7-9-5-3-4-6-11(9)12-10/h9-10H,2-8H2,1H3 |
| InChIKey | NQRXNZGVXALNMB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |