About tert-butyl [4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]but-2-enyl] carbonate
tert-butyl [4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]but-2-enyl] carbonate (PubChem CID 89326737) has the molecular formula C21H40O7Si
and a molecular weight of 432.63 g/mol. Its IUPAC name is tert-butyl [4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]but-2-enyl] carbonate.
Molecular Properties
| Compound Name | tert-butyl [4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]but-2-enyl] carbonate |
| PubChem CID | 89326737 |
| Molecular Formula | C21H40O7Si |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | tert-butyl [4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]but-2-enyl] carbonate |
| SMILES | CC(C)(C)OC(=O)OCC(=CCO[Si](C)(C)C(C)(C)C)COC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H40O7Si/c1-19(2,3)27-17(22)24-14-16(15-25-18(23)28-20(4,5)6)12-13-26-29(10,11)21(7,8)9/h12H,13-15H2,1-11H3 |
| InChIKey | RXYRRYOMEFPBPI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl [4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]but-2-enyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl [4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]but-2-enyl] carbonate?
The IUPAC name of tert-butyl [4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]but-2-enyl] carbonate (CID 89326737) is tert-butyl [4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]but-2-enyl] carbonate.
What is the SMILES notation for tert-butyl [4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]but-2-enyl] carbonate?
The canonical SMILES for tert-butyl [4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]but-2-enyl] carbonate is CC(C)(C)OC(=O)OCC(=CCO[Si](C)(C)C(C)(C)C)COC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl [4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]but-2-enyl] carbonate?
The InChIKey is RXYRRYOMEFPBPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40O7Si/c1-19(2,3)27-17(22)24-14-16(15-25-18(23)28-20(4,5)6)12-13-26-29(10,11)21(7,8)9/h12H,13-15H2,1-11H3.
What are the key properties of tert-butyl [4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]but-2-enyl] carbonate?
tert-butyl [4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]but-2-enyl] carbonate has a molecular weight of 432.63 g/mol, XLogP of 5.84, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl [4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]but-2-enyl] carbonate is sourced from PubChem (CID 89326737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).