C9H16N2 — CID 89326808
2-methanimidoyl-3,3,4,4-tetramethylcyclobuten-1-amine (PubChem CID 89326808) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-methanimidoyl-3,3,4,4-tetramethylcyclobuten-1-amine.
| Compound Name | 2-methanimidoyl-3,3,4,4-tetramethylcyclobuten-1-amine |
|---|---|
| PubChem CID | 89326808 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2-methanimidoyl-3,3,4,4-tetramethylcyclobuten-1-amine |
| SMILES | [H]/N=C/C1=C(N)C(C)(C)C1(C)C |
| InChI | InChI=1S/C9H16N2/c1-8(2)6(5-10)7(11)9(8,3)4/h5,10H,11H2,1-4H3/b10-5+ |
| InChIKey | MDLXPXBJEPAONG-BJMVGYQFSA-N |
| XLogP | 1.91 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|