C26H30IN3O3S — CID 89326833
3-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-6-[4-(iodomethyl)phenyl]-6,7-dihydrothieno[3,2-d]pyrimidin-4-one (PubChem CID 89326833) has the molecular formula C26H30IN3O3S and a molecular weight of 591.52 g/mol. Its IUPAC name is 3-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-6-[4-(iodomethyl)phenyl]-6,7-dihydrothieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-6-[4-(iodomethyl)phenyl]-6,7-dihydrothieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 89326833 |
| Molecular Formula | C26H30IN3O3S |
| Molecular Weight | 591.52 g/mol |
| Exact Mass | 591.11 |
| IUPAC Name | 3-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-6-[4-(iodomethyl)phenyl]-6,7-dihydrothieno[3,2-d]pyrimidin-4-one |
| SMILES | CCN(CC)CCOc1ccc(-n2cnc3c(c2=O)SC(c2ccc(CI)cc2)C3)cc1OC |
| InChI | InChI=1S/C26H30IN3O3S/c1-4-29(5-2)12-13-33-22-11-10-20(14-23(22)32-3)30-17-28-21-15-24(34-25(21)26(30)31)19-8-6-18(16-27)7-9-19/h6-11,14,17,24H,4-5,12-13,15-16H2,1-3H3 |
| InChIKey | AOGSBNKEERSVMF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|