C22H30N6O4 — CID 89326950
N-butyl-4-[5-[3-(butylcarbamoyl)-5-oxo-1,2-dihydropyrazol-4-yl]-3-methylpenta-2,4-dienylidene]-5-oxo-1H-pyrazole-3-carboxamide (PubChem CID 89326950) has the molecular formula C22H30N6O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-butyl-4-[5-[3-(butylcarbamoyl)-5-oxo-1,2-dihydropyrazol-4-yl]-3-methylpenta-2,4-dienylidene]-5-oxo-1H-pyrazole-3-carboxamide.
| Compound Name | N-butyl-4-[5-[3-(butylcarbamoyl)-5-oxo-1,2-dihydropyrazol-4-yl]-3-methylpenta-2,4-dienylidene]-5-oxo-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 89326950 |
| Molecular Formula | C22H30N6O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | N-butyl-4-[5-[3-(butylcarbamoyl)-5-oxo-1,2-dihydropyrazol-4-yl]-3-methylpenta-2,4-dienylidene]-5-oxo-1H-pyrazole-3-carboxamide |
| SMILES | CCCCNC(=O)C1=NNC(=O)C1=CC=C(C)C=Cc1c(C(=O)NCCCC)[nH][nH]c1=O |
| InChI | InChI=1S/C22H30N6O4/c1-4-6-12-23-21(31)17-15(19(29)27-25-17)10-8-14(3)9-11-16-18(26-28-20(16)30)22(32)24-13-7-5-2/h8-11H,4-7,12-13H2,1-3H3,(H,23,31)(H,24,32)(H,27,29)(H2,26,28,30) |
| InChIKey | VSMIJPMDBXXBLV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|