C16H14O6 — CID 89327478
5-(2,5-dioxooxolan-3-yl)-3a,4,5,6,7,9b-hexahydrobenzo[e][2]benzofuran-1,3-dione (PubChem CID 89327478) has the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. Its IUPAC name is 5-(2,5-dioxooxolan-3-yl)-3a,4,5,6,7,9b-hexahydrobenzo[e][2]benzofuran-1,3-dione.
| Compound Name | 5-(2,5-dioxooxolan-3-yl)-3a,4,5,6,7,9b-hexahydrobenzo[e][2]benzofuran-1,3-dione |
|---|---|
| PubChem CID | 89327478 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 5-(2,5-dioxooxolan-3-yl)-3a,4,5,6,7,9b-hexahydrobenzo[e][2]benzofuran-1,3-dione |
| SMILES | O=C1CC(C2CC3C(=O)OC(=O)C3C3=C2CCC=C3)C(=O)O1 |
| InChI | InChI=1S/C16H14O6/c17-12-6-10(14(18)21-12)9-5-11-13(16(20)22-15(11)19)8-4-2-1-3-7(8)9/h2,4,9-11,13H,1,3,5-6H2 |
| InChIKey | FPXDWYFQPMFRBT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|