About 5-(4-methylcyclohexa-1,3-dien-1-yl)-3,4-dihydropyridine
5-(4-methylcyclohexa-1,3-dien-1-yl)-3,4-dihydropyridine (PubChem CID 89327957) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 5-(4-methylcyclohexa-1,3-dien-1-yl)-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 5-(4-methylcyclohexa-1,3-dien-1-yl)-3,4-dihydropyridine |
| PubChem CID | 89327957 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 5-(4-methylcyclohexa-1,3-dien-1-yl)-3,4-dihydropyridine |
| SMILES | CC1=CC=C(C2=CN=CCC2)CC1 |
| InChI | InChI=1S/C12H15N/c1-10-4-6-11(7-5-10)12-3-2-8-13-9-12/h4,6,8-9H,2-3,5,7H2,1H3 |
| InChIKey | PYCLUDVZYTZJCJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(4-methylcyclohexa-1,3-dien-1-yl)-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methylcyclohexa-1,3-dien-1-yl)-3,4-dihydropyridine?
The IUPAC name of 5-(4-methylcyclohexa-1,3-dien-1-yl)-3,4-dihydropyridine (CID 89327957) is 5-(4-methylcyclohexa-1,3-dien-1-yl)-3,4-dihydropyridine.
What is the SMILES notation for 5-(4-methylcyclohexa-1,3-dien-1-yl)-3,4-dihydropyridine?
The canonical SMILES for 5-(4-methylcyclohexa-1,3-dien-1-yl)-3,4-dihydropyridine is CC1=CC=C(C2=CN=CCC2)CC1.
What is the InChIKey of 5-(4-methylcyclohexa-1,3-dien-1-yl)-3,4-dihydropyridine?
The InChIKey is PYCLUDVZYTZJCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c1-10-4-6-11(7-5-10)12-3-2-8-13-9-12/h4,6,8-9H,2-3,5,7H2,1H3.
What are the key properties of 5-(4-methylcyclohexa-1,3-dien-1-yl)-3,4-dihydropyridine?
5-(4-methylcyclohexa-1,3-dien-1-yl)-3,4-dihydropyridine has a molecular weight of 173.26 g/mol, XLogP of 3.40, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methylcyclohexa-1,3-dien-1-yl)-3,4-dihydropyridine is sourced from PubChem (CID 89327957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).