C14H23N — CID 89327958
(2Z,7E)-N,4-dimethyl-5-[(Z)-prop-1-enyl]nona-2,7-dien-1-imine (PubChem CID 89327958) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (2Z,7E)-N,4-dimethyl-5-[(Z)-prop-1-enyl]nona-2,7-dien-1-imine.
| Compound Name | (2Z,7E)-N,4-dimethyl-5-[(Z)-prop-1-enyl]nona-2,7-dien-1-imine |
|---|---|
| PubChem CID | 89327958 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (2Z,7E)-N,4-dimethyl-5-[(Z)-prop-1-enyl]nona-2,7-dien-1-imine |
| SMILES | C/C=C\C(C/C=C/C)C(C)/C=C\C=N\C |
| InChI | InChI=1S/C14H23N/c1-5-7-11-14(9-6-2)13(3)10-8-12-15-4/h5-10,12-14H,11H2,1-4H3/b7-5+,9-6-,10-8-,15-12+ |
| InChIKey | JVINTAPXQRUWOG-DQTKTAHDSA-N |
| XLogP | 4.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|