C14H21N5O4 — CID 8932798
[(Z)-1-[(2S)-3-hydroxy-2,4,4-trimethyl-5-(5-methylfuran-2-yl)-1-oxidoimidazol-1-ium-2-yl]ethylideneamino]urea (PubChem CID 8932798) has the molecular formula C14H21N5O4 and a molecular weight of 323.35 g/mol. Its IUPAC name is [(Z)-1-[(2S)-3-hydroxy-2,4,4-trimethyl-5-(5-methylfuran-2-yl)-1-oxidoimidazol-1-ium-2-yl]ethylideneamino]urea.
| Compound Name | [(Z)-1-[(2S)-3-hydroxy-2,4,4-trimethyl-5-(5-methylfuran-2-yl)-1-oxidoimidazol-1-ium-2-yl]ethylideneamino]urea |
|---|---|
| PubChem CID | 8932798 |
| Molecular Formula | C14H21N5O4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | [(Z)-1-[(2S)-3-hydroxy-2,4,4-trimethyl-5-(5-methylfuran-2-yl)-1-oxidoimidazol-1-ium-2-yl]ethylideneamino]urea |
| SMILES | C/C(=N/NC(N)=O)[C@@]1(C)N(O)C(C)(C)C(c2ccc(C)o2)=[N+]1[O-] |
| InChI | InChI=1S/C14H21N5O4/c1-8-6-7-10(23-8)11-13(3,4)19(22)14(5,18(11)21)9(2)16-17-12(15)20/h6-7,22H,1-5H3,(H3,15,17,20)/b16-9-/t14-/m1/s1 |
| InChIKey | CXWFAWRNHAIOTP-SLVCOGOPSA-N |
| XLogP | 1.13 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|