About 2-cyclohexa-1,5-dien-1-ylcyclopropen-1-ol
2-cyclohexa-1,5-dien-1-ylcyclopropen-1-ol (PubChem CID 89328023) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-ylcyclopropen-1-ol.
Molecular Properties
| Compound Name | 2-cyclohexa-1,5-dien-1-ylcyclopropen-1-ol |
| PubChem CID | 89328023 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-ylcyclopropen-1-ol |
| SMILES | OC1=C(C2=CCCC=C2)C1 |
| InChI | InChI=1S/C9H10O/c10-9-6-8(9)7-4-2-1-3-5-7/h2,4-5,10H,1,3,6H2 |
| InChIKey | OAUQBLYHGRZNIM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclohexa-1,5-dien-1-ylcyclopropen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-1,5-dien-1-ylcyclopropen-1-ol?
The IUPAC name of 2-cyclohexa-1,5-dien-1-ylcyclopropen-1-ol (CID 89328023) is 2-cyclohexa-1,5-dien-1-ylcyclopropen-1-ol.
What is the SMILES notation for 2-cyclohexa-1,5-dien-1-ylcyclopropen-1-ol?
The canonical SMILES for 2-cyclohexa-1,5-dien-1-ylcyclopropen-1-ol is OC1=C(C2=CCCC=C2)C1.
What is the InChIKey of 2-cyclohexa-1,5-dien-1-ylcyclopropen-1-ol?
The InChIKey is OAUQBLYHGRZNIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O/c10-9-6-8(9)7-4-2-1-3-5-7/h2,4-5,10H,1,3,6H2.
What are the key properties of 2-cyclohexa-1,5-dien-1-ylcyclopropen-1-ol?
2-cyclohexa-1,5-dien-1-ylcyclopropen-1-ol has a molecular weight of 134.18 g/mol, XLogP of 2.48, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-1,5-dien-1-ylcyclopropen-1-ol is sourced from PubChem (CID 89328023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).