About 4-(3-hydroxy-3-methylpentoxy)-2,4-dimethylhex-1-en-3-one
4-(3-hydroxy-3-methylpentoxy)-2,4-dimethylhex-1-en-3-one (PubChem CID 89328055) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is 4-(3-hydroxy-3-methylpentoxy)-2,4-dimethylhex-1-en-3-one.
Molecular Properties
| Compound Name | 4-(3-hydroxy-3-methylpentoxy)-2,4-dimethylhex-1-en-3-one |
| PubChem CID | 89328055 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 4-(3-hydroxy-3-methylpentoxy)-2,4-dimethylhex-1-en-3-one |
| SMILES | C=C(C)C(=O)C(C)(CC)OCCC(C)(O)CC |
| InChI | InChI=1S/C14H26O3/c1-7-13(5,16)9-10-17-14(6,8-2)12(15)11(3)4/h16H,3,7-10H2,1-2,4-6H3 |
| InChIKey | DREDDUOGNWLFGA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-hydroxy-3-methylpentoxy)-2,4-dimethylhex-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-hydroxy-3-methylpentoxy)-2,4-dimethylhex-1-en-3-one?
The IUPAC name of 4-(3-hydroxy-3-methylpentoxy)-2,4-dimethylhex-1-en-3-one (CID 89328055) is 4-(3-hydroxy-3-methylpentoxy)-2,4-dimethylhex-1-en-3-one.
What is the SMILES notation for 4-(3-hydroxy-3-methylpentoxy)-2,4-dimethylhex-1-en-3-one?
The canonical SMILES for 4-(3-hydroxy-3-methylpentoxy)-2,4-dimethylhex-1-en-3-one is C=C(C)C(=O)C(C)(CC)OCCC(C)(O)CC.
What is the InChIKey of 4-(3-hydroxy-3-methylpentoxy)-2,4-dimethylhex-1-en-3-one?
The InChIKey is DREDDUOGNWLFGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c1-7-13(5,16)9-10-17-14(6,8-2)12(15)11(3)4/h16H,3,7-10H2,1-2,4-6H3.
What are the key properties of 4-(3-hydroxy-3-methylpentoxy)-2,4-dimethylhex-1-en-3-one?
4-(3-hydroxy-3-methylpentoxy)-2,4-dimethylhex-1-en-3-one has a molecular weight of 242.36 g/mol, XLogP of 2.87, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-hydroxy-3-methylpentoxy)-2,4-dimethylhex-1-en-3-one is sourced from PubChem (CID 89328055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).