About (2Z,4Z)-N-[2-(disulfanyl)ethyl]hexa-2,4-dien-2-amine
(2Z,4Z)-N-[2-(disulfanyl)ethyl]hexa-2,4-dien-2-amine (PubChem CID 89328144) has the molecular formula C8H15NS2
and a molecular weight of 189.35 g/mol. Its IUPAC name is (2Z,4Z)-N-[2-(disulfanyl)ethyl]hexa-2,4-dien-2-amine.
Molecular Properties
| Compound Name | (2Z,4Z)-N-[2-(disulfanyl)ethyl]hexa-2,4-dien-2-amine |
| PubChem CID | 89328144 |
| Molecular Formula | C8H15NS2 |
| Molecular Weight | 189.35 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | (2Z,4Z)-N-[2-(disulfanyl)ethyl]hexa-2,4-dien-2-amine |
| SMILES | C/C=C\C=C(\C)NCCSS |
| InChI | InChI=1S/C8H15NS2/c1-3-4-5-8(2)9-6-7-11-10/h3-5,9-10H,6-7H2,1-2H3/b4-3-,8-5- |
| InChIKey | KGOLOFSTHJWMOL-UBNNFMAXSA-N |
| XLogP | 2.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-N-[2-(disulfanyl)ethyl]hexa-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-N-[2-(disulfanyl)ethyl]hexa-2,4-dien-2-amine?
The IUPAC name of (2Z,4Z)-N-[2-(disulfanyl)ethyl]hexa-2,4-dien-2-amine (CID 89328144) is (2Z,4Z)-N-[2-(disulfanyl)ethyl]hexa-2,4-dien-2-amine.
What is the SMILES notation for (2Z,4Z)-N-[2-(disulfanyl)ethyl]hexa-2,4-dien-2-amine?
The canonical SMILES for (2Z,4Z)-N-[2-(disulfanyl)ethyl]hexa-2,4-dien-2-amine is C/C=C\C=C(\C)NCCSS.
What is the InChIKey of (2Z,4Z)-N-[2-(disulfanyl)ethyl]hexa-2,4-dien-2-amine?
The InChIKey is KGOLOFSTHJWMOL-UBNNFMAXSA-N. The full InChI is InChI=1S/C8H15NS2/c1-3-4-5-8(2)9-6-7-11-10/h3-5,9-10H,6-7H2,1-2H3/b4-3-,8-5-.
What are the key properties of (2Z,4Z)-N-[2-(disulfanyl)ethyl]hexa-2,4-dien-2-amine?
(2Z,4Z)-N-[2-(disulfanyl)ethyl]hexa-2,4-dien-2-amine has a molecular weight of 189.35 g/mol, XLogP of 2.63, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-N-[2-(disulfanyl)ethyl]hexa-2,4-dien-2-amine is sourced from PubChem (CID 89328144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).