C8H13F2NO — CID 89328210
[(3S,3aS,6aR)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3-yl]methanol (PubChem CID 89328210) has the molecular formula C8H13F2NO and a molecular weight of 177.19 g/mol. Its IUPAC name is [(3S,3aS,6aR)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3-yl]methanol.
| Compound Name | [(3S,3aS,6aR)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 89328210 |
| Molecular Formula | C8H13F2NO |
| Molecular Weight | 177.19 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | [(3S,3aS,6aR)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3-yl]methanol |
| SMILES | OC[C@H]1NC[C@@H]2CC(F)(F)C[C@@H]21 |
| InChI | InChI=1S/C8H13F2NO/c9-8(10)1-5-3-11-7(4-12)6(5)2-8/h5-7,11-12H,1-4H2/t5-,6-,7+/m0/s1 |
| InChIKey | PPDBVAKUESXGDS-LYFYHCNISA-N |
| XLogP | 0.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |