About 1-cyclohexa-1,5-dien-1-ylbutan-1-ol
1-cyclohexa-1,5-dien-1-ylbutan-1-ol (PubChem CID 89328454) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-ylbutan-1-ol.
Molecular Properties
| Compound Name | 1-cyclohexa-1,5-dien-1-ylbutan-1-ol |
| PubChem CID | 89328454 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-ylbutan-1-ol |
| SMILES | CCCC(O)C1=CCCC=C1 |
| InChI | InChI=1S/C10H16O/c1-2-6-10(11)9-7-4-3-5-8-9/h4,7-8,10-11H,2-3,5-6H2,1H3 |
| InChIKey | QEQHSFCUROKGKQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexa-1,5-dien-1-ylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,5-dien-1-ylbutan-1-ol?
The IUPAC name of 1-cyclohexa-1,5-dien-1-ylbutan-1-ol (CID 89328454) is 1-cyclohexa-1,5-dien-1-ylbutan-1-ol.
What is the SMILES notation for 1-cyclohexa-1,5-dien-1-ylbutan-1-ol?
The canonical SMILES for 1-cyclohexa-1,5-dien-1-ylbutan-1-ol is CCCC(O)C1=CCCC=C1.
What is the InChIKey of 1-cyclohexa-1,5-dien-1-ylbutan-1-ol?
The InChIKey is QEQHSFCUROKGKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O/c1-2-6-10(11)9-7-4-3-5-8-9/h4,7-8,10-11H,2-3,5-6H2,1H3.
What are the key properties of 1-cyclohexa-1,5-dien-1-ylbutan-1-ol?
1-cyclohexa-1,5-dien-1-ylbutan-1-ol has a molecular weight of 152.24 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,5-dien-1-ylbutan-1-ol is sourced from PubChem (CID 89328454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).