C10H15F3N2O5 — CID 89328487
4-hydroxy-5-(hydroxymethyl)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]oxolane-2-carboxamide (PubChem CID 89328487) has the molecular formula C10H15F3N2O5 and a molecular weight of 300.23 g/mol. Its IUPAC name is 4-hydroxy-5-(hydroxymethyl)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]oxolane-2-carboxamide.
| Compound Name | 4-hydroxy-5-(hydroxymethyl)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 89328487 |
| Molecular Formula | C10H15F3N2O5 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4-hydroxy-5-(hydroxymethyl)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]oxolane-2-carboxamide |
| SMILES | O=C(NCCNC(=O)C(F)(F)F)C1CC(O)C(CO)O1 |
| InChI | InChI=1S/C10H15F3N2O5/c11-10(12,13)9(19)15-2-1-14-8(18)6-3-5(17)7(4-16)20-6/h5-7,16-17H,1-4H2,(H,14,18)(H,15,19) |
| InChIKey | SIKKGQRBAIAWBE-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|