About N'-[3-[(2S,5S)-4-acetyl-5-methylpiperazin-2-yl]propyl]ethanimidamide
N'-[3-[(2S,5S)-4-acetyl-5-methylpiperazin-2-yl]propyl]ethanimidamide (PubChem CID 89328660) has the molecular formula C12H24N4O
and a molecular weight of 240.35 g/mol. Its IUPAC name is N'-[3-[(2S,5S)-4-acetyl-5-methylpiperazin-2-yl]propyl]ethanimidamide.
Molecular Properties
| Compound Name | N'-[3-[(2S,5S)-4-acetyl-5-methylpiperazin-2-yl]propyl]ethanimidamide |
| PubChem CID | 89328660 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | N'-[3-[(2S,5S)-4-acetyl-5-methylpiperazin-2-yl]propyl]ethanimidamide |
| SMILES | CC(=O)N1C[C@H](CCC/N=C(\C)N)NC[C@@H]1C |
| InChI | InChI=1S/C12H24N4O/c1-9-7-15-12(8-16(9)11(3)17)5-4-6-14-10(2)13/h9,12,15H,4-8H2,1-3H3,(H2,13,14)/t9-,12-/m0/s1 |
| InChIKey | MBAGBOMWASOVDB-CABZTGNLSA-N |
| XLogP | 0.35 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[3-[(2S,5S)-4-acetyl-5-methylpiperazin-2-yl]propyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-[(2S,5S)-4-acetyl-5-methylpiperazin-2-yl]propyl]ethanimidamide?
The IUPAC name of N'-[3-[(2S,5S)-4-acetyl-5-methylpiperazin-2-yl]propyl]ethanimidamide (CID 89328660) is N'-[3-[(2S,5S)-4-acetyl-5-methylpiperazin-2-yl]propyl]ethanimidamide.
What is the SMILES notation for N'-[3-[(2S,5S)-4-acetyl-5-methylpiperazin-2-yl]propyl]ethanimidamide?
The canonical SMILES for N'-[3-[(2S,5S)-4-acetyl-5-methylpiperazin-2-yl]propyl]ethanimidamide is CC(=O)N1C[C@H](CCC/N=C(\C)N)NC[C@@H]1C.
What is the InChIKey of N'-[3-[(2S,5S)-4-acetyl-5-methylpiperazin-2-yl]propyl]ethanimidamide?
The InChIKey is MBAGBOMWASOVDB-CABZTGNLSA-N. The full InChI is InChI=1S/C12H24N4O/c1-9-7-15-12(8-16(9)11(3)17)5-4-6-14-10(2)13/h9,12,15H,4-8H2,1-3H3,(H2,13,14)/t9-,12-/m0/s1.
What are the key properties of N'-[3-[(2S,5S)-4-acetyl-5-methylpiperazin-2-yl]propyl]ethanimidamide?
N'-[3-[(2S,5S)-4-acetyl-5-methylpiperazin-2-yl]propyl]ethanimidamide has a molecular weight of 240.35 g/mol, XLogP of 0.35, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-[(2S,5S)-4-acetyl-5-methylpiperazin-2-yl]propyl]ethanimidamide is sourced from PubChem (CID 89328660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).