About (5R)-5-methylcyclohexa-1,3-diene-1-thiol
(5R)-5-methylcyclohexa-1,3-diene-1-thiol (PubChem CID 89328664) has the molecular formula C7H10S
and a molecular weight of 126.22 g/mol. Its IUPAC name is (5R)-5-methylcyclohexa-1,3-diene-1-thiol.
Molecular Properties
| Compound Name | (5R)-5-methylcyclohexa-1,3-diene-1-thiol |
| PubChem CID | 89328664 |
| Molecular Formula | C7H10S |
| Molecular Weight | 126.22 g/mol |
| Exact Mass | 126.05 |
| IUPAC Name | (5R)-5-methylcyclohexa-1,3-diene-1-thiol |
| SMILES | C[C@H]1C=CC=C(S)C1 |
| InChI | InChI=1S/C7H10S/c1-6-3-2-4-7(8)5-6/h2-4,6,8H,5H2,1H3/t6-/m0/s1 |
| InChIKey | JQLNVKCUJJWZRH-LURJTMIESA-N |
| XLogP | 2.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-methylcyclohexa-1,3-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-methylcyclohexa-1,3-diene-1-thiol?
The IUPAC name of (5R)-5-methylcyclohexa-1,3-diene-1-thiol (CID 89328664) is (5R)-5-methylcyclohexa-1,3-diene-1-thiol.
What is the SMILES notation for (5R)-5-methylcyclohexa-1,3-diene-1-thiol?
The canonical SMILES for (5R)-5-methylcyclohexa-1,3-diene-1-thiol is C[C@H]1C=CC=C(S)C1.
What is the InChIKey of (5R)-5-methylcyclohexa-1,3-diene-1-thiol?
The InChIKey is JQLNVKCUJJWZRH-LURJTMIESA-N. The full InChI is InChI=1S/C7H10S/c1-6-3-2-4-7(8)5-6/h2-4,6,8H,5H2,1H3/t6-/m0/s1.
What are the key properties of (5R)-5-methylcyclohexa-1,3-diene-1-thiol?
(5R)-5-methylcyclohexa-1,3-diene-1-thiol has a molecular weight of 126.22 g/mol, XLogP of 2.40, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-methylcyclohexa-1,3-diene-1-thiol is sourced from PubChem (CID 89328664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).