C10H17N3 — CID 89328680
1-methyl-1-[(3E,5Z)-octa-1,3,5-trien-3-yl]guanidine (PubChem CID 89328680) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-methyl-1-[(3E,5Z)-octa-1,3,5-trien-3-yl]guanidine.
| Compound Name | 1-methyl-1-[(3E,5Z)-octa-1,3,5-trien-3-yl]guanidine |
|---|---|
| PubChem CID | 89328680 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-methyl-1-[(3E,5Z)-octa-1,3,5-trien-3-yl]guanidine |
| SMILES | [H]/N=C(\N)N(C)/C(C=C)=C/C=C\CC |
| InChI | InChI=1S/C10H17N3/c1-4-6-7-8-9(5-2)13(3)10(11)12/h5-8H,2,4H2,1,3H3,(H3,11,12)/b7-6-,9-8+ |
| InChIKey | FOWOBIUJQZSEQK-NMMTYZSQSA-N |
| XLogP | 1.85 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|