C14H10F4 — CID 89328807
1,2,3,4-tetrafluoro-5-[(4-methylphenyl)methyl]benzene (PubChem CID 89328807) has the molecular formula C14H10F4 and a molecular weight of 254.23 g/mol. Its IUPAC name is 1,2,3,4-tetrafluoro-5-[(4-methylphenyl)methyl]benzene.
| Compound Name | 1,2,3,4-tetrafluoro-5-[(4-methylphenyl)methyl]benzene |
|---|---|
| PubChem CID | 89328807 |
| Molecular Formula | C14H10F4 |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 1,2,3,4-tetrafluoro-5-[(4-methylphenyl)methyl]benzene |
| SMILES | Cc1ccc(Cc2cc(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C14H10F4/c1-8-2-4-9(5-3-8)6-10-7-11(15)13(17)14(18)12(10)16/h2-5,7H,6H2,1H3 |
| InChIKey | MQUJOVPTWCHARR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|