C12H22O4 — CID 89329031
(2S)-3-[(2R,3R,4S,5S)-3-methoxy-4-methyl-5-prop-2-enyloxolan-2-yl]propane-1,2-diol (PubChem CID 89329031) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is (2S)-3-[(2R,3R,4S,5S)-3-methoxy-4-methyl-5-prop-2-enyloxolan-2-yl]propane-1,2-diol.
| Compound Name | (2S)-3-[(2R,3R,4S,5S)-3-methoxy-4-methyl-5-prop-2-enyloxolan-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 89329031 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (2S)-3-[(2R,3R,4S,5S)-3-methoxy-4-methyl-5-prop-2-enyloxolan-2-yl]propane-1,2-diol |
| SMILES | C=CC[C@@H]1O[C@H](C[C@H](O)CO)[C@H](OC)[C@H]1C |
| InChI | InChI=1S/C12H22O4/c1-4-5-10-8(2)12(15-3)11(16-10)6-9(14)7-13/h4,8-14H,1,5-7H2,2-3H3/t8-,9-,10-,11+,12+/m0/s1 |
| InChIKey | OUIIVRRGPXGTSJ-KKJSVHSVSA-N |
| XLogP | 0.72 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|