C13H24O — CID 89329328
(3E,5E)-8-methoxy-7,7-dimethyldeca-3,5-diene (PubChem CID 89329328) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (3E,5E)-8-methoxy-7,7-dimethyldeca-3,5-diene.
| Compound Name | (3E,5E)-8-methoxy-7,7-dimethyldeca-3,5-diene |
|---|---|
| PubChem CID | 89329328 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (3E,5E)-8-methoxy-7,7-dimethyldeca-3,5-diene |
| SMILES | CC/C=C/C=C/C(C)(C)C(CC)OC |
| InChI | InChI=1S/C13H24O/c1-6-8-9-10-11-13(3,4)12(7-2)14-5/h8-12H,6-7H2,1-5H3/b9-8+,11-10+ |
| InChIKey | ATLJQCXWEVTFKZ-BNFZFUHLSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|