About N-[(E)-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]amino]methanamine
N-[(E)-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]amino]methanamine (PubChem CID 89329449) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is N-[(E)-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]amino]methanamine.
Molecular Properties
| Compound Name | N-[(E)-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]amino]methanamine |
| PubChem CID | 89329449 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N-[(E)-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]amino]methanamine |
| SMILES | C/C=C\C=C/C(C)=N/NC |
| InChI | InChI=1S/C8H14N2/c1-4-5-6-7-8(2)10-9-3/h4-7,9H,1-3H3/b5-4-,7-6-,10-8+ |
| InChIKey | DCXCJTVGBSNKOQ-SAEJHGFRSA-N |
| XLogP | 1.71 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]amino]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]amino]methanamine?
The IUPAC name of N-[(E)-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]amino]methanamine (CID 89329449) is N-[(E)-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]amino]methanamine.
What is the SMILES notation for N-[(E)-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]amino]methanamine?
The canonical SMILES for N-[(E)-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]amino]methanamine is C/C=C\C=C/C(C)=N/NC.
What is the InChIKey of N-[(E)-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]amino]methanamine?
The InChIKey is DCXCJTVGBSNKOQ-SAEJHGFRSA-N. The full InChI is InChI=1S/C8H14N2/c1-4-5-6-7-8(2)10-9-3/h4-7,9H,1-3H3/b5-4-,7-6-,10-8+.
What are the key properties of N-[(E)-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]amino]methanamine?
N-[(E)-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]amino]methanamine has a molecular weight of 138.21 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-[(3Z,5Z)-hepta-3,5-dien-2-ylidene]amino]methanamine is sourced from PubChem (CID 89329449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).