C36H27ClO10 — CID 89329551
[4-[3-chloro-4-[4-(4-hydroxybenzoyl)oxyphenyl]phenoxy]carbonylphenyl] 2,4,5-trimethoxybenzoate (PubChem CID 89329551) has the molecular formula C36H27ClO10 and a molecular weight of 655.06 g/mol. Its IUPAC name is [4-[3-chloro-4-[4-(4-hydroxybenzoyl)oxyphenyl]phenoxy]carbonylphenyl] 2,4,5-trimethoxybenzoate.
| Compound Name | [4-[3-chloro-4-[4-(4-hydroxybenzoyl)oxyphenyl]phenoxy]carbonylphenyl] 2,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 89329551 |
| Molecular Formula | C36H27ClO10 |
| Molecular Weight | 655.06 g/mol |
| Exact Mass | 654.13 |
| IUPAC Name | [4-[3-chloro-4-[4-(4-hydroxybenzoyl)oxyphenyl]phenoxy]carbonylphenyl] 2,4,5-trimethoxybenzoate |
| SMILES | COc1cc(OC)c(C(=O)Oc2ccc(C(=O)Oc3ccc(-c4ccc(OC(=O)c5ccc(O)cc5)cc4)c(Cl)c3)cc2)cc1OC |
| InChI | InChI=1S/C36H27ClO10/c1-42-31-20-33(44-3)32(43-2)19-29(31)36(41)46-26-14-8-23(9-15-26)35(40)47-27-16-17-28(30(37)18-27)21-6-12-25(13-7-21)45-34(39)22-4-10-24(38)11-5-22/h4-20,38H,1-3H3 |
| InChIKey | JZMPCODOTOODLP-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.06 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|