C22H19IN6S — CID 89329732
4-N-(1H-indazol-5-yl)-2-N-[[3-(iodomethyl)-4-methylphenyl]methyl]thieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 89329732) has the molecular formula C22H19IN6S and a molecular weight of 526.41 g/mol. Its IUPAC name is 4-N-(1H-indazol-5-yl)-2-N-[[3-(iodomethyl)-4-methylphenyl]methyl]thieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(1H-indazol-5-yl)-2-N-[[3-(iodomethyl)-4-methylphenyl]methyl]thieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 89329732 |
| Molecular Formula | C22H19IN6S |
| Molecular Weight | 526.41 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | 4-N-(1H-indazol-5-yl)-2-N-[[3-(iodomethyl)-4-methylphenyl]methyl]thieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | Cc1ccc(CNc2nc(Nc3ccc4[nH]ncc4c3)c3sccc3n2)cc1CI |
| InChI | InChI=1S/C22H19IN6S/c1-13-2-3-14(8-15(13)10-23)11-24-22-27-19-6-7-30-20(19)21(28-22)26-17-4-5-18-16(9-17)12-25-29-18/h2-9,12H,10-11H2,1H3,(H,25,29)(H2,24,26,27,28) |
| InChIKey | RNIMRCMKCMGOGJ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.41 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|