About (2S)-3-methylidenebutane-1,2,4-triol
(2S)-3-methylidenebutane-1,2,4-triol (PubChem CID 89329915) has the molecular formula C5H10O3
and a molecular weight of 118.13 g/mol. Its IUPAC name is (2S)-3-methylidenebutane-1,2,4-triol.
Molecular Properties
| Compound Name | (2S)-3-methylidenebutane-1,2,4-triol |
| PubChem CID | 89329915 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | (2S)-3-methylidenebutane-1,2,4-triol |
| SMILES | C=C(CO)[C@H](O)CO |
| InChI | InChI=1S/C5H10O3/c1-4(2-6)5(8)3-7/h5-8H,1-3H2/t5-/m1/s1 |
| InChIKey | PGARYUHLQUORKU-RXMQYKEDSA-N |
| XLogP | -1.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3-methylidenebutane-1,2,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-methylidenebutane-1,2,4-triol?
The IUPAC name of (2S)-3-methylidenebutane-1,2,4-triol (CID 89329915) is (2S)-3-methylidenebutane-1,2,4-triol.
What is the SMILES notation for (2S)-3-methylidenebutane-1,2,4-triol?
The canonical SMILES for (2S)-3-methylidenebutane-1,2,4-triol is C=C(CO)[C@H](O)CO.
What is the InChIKey of (2S)-3-methylidenebutane-1,2,4-triol?
The InChIKey is PGARYUHLQUORKU-RXMQYKEDSA-N. The full InChI is InChI=1S/C5H10O3/c1-4(2-6)5(8)3-7/h5-8H,1-3H2/t5-/m1/s1.
What are the key properties of (2S)-3-methylidenebutane-1,2,4-triol?
(2S)-3-methylidenebutane-1,2,4-triol has a molecular weight of 118.13 g/mol, XLogP of -1.11, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-methylidenebutane-1,2,4-triol is sourced from PubChem (CID 89329915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).