C16H20BrN3O3 — CID 89330047
8-(2-bromo-4,6-dimethylphenyl)-3-methoxy-1,2,4,5-tetrahydropyrazolo[1,2-a][1,2,5]triazepine-7,9-dione (PubChem CID 89330047) has the molecular formula C16H20BrN3O3 and a molecular weight of 382.26 g/mol. Its IUPAC name is 8-(2-bromo-4,6-dimethylphenyl)-3-methoxy-1,2,4,5-tetrahydropyrazolo[1,2-a][1,2,5]triazepine-7,9-dione.
| Compound Name | 8-(2-bromo-4,6-dimethylphenyl)-3-methoxy-1,2,4,5-tetrahydropyrazolo[1,2-a][1,2,5]triazepine-7,9-dione |
|---|---|
| PubChem CID | 89330047 |
| Molecular Formula | C16H20BrN3O3 |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 8-(2-bromo-4,6-dimethylphenyl)-3-methoxy-1,2,4,5-tetrahydropyrazolo[1,2-a][1,2,5]triazepine-7,9-dione |
| SMILES | CON1CCN2C(=O)C(c3c(C)cc(C)cc3Br)C(=O)N2CC1 |
| InChI | InChI=1S/C16H20BrN3O3/c1-10-8-11(2)13(12(17)9-10)14-15(21)19-6-4-18(23-3)5-7-20(19)16(14)22/h8-9,14H,4-7H2,1-3H3 |
| InChIKey | DDWQYJXINIBAAO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|