About 4-fluorocyclohexa-1,5-diene-1-carbothialdehyde
4-fluorocyclohexa-1,5-diene-1-carbothialdehyde (PubChem CID 89330132) has the molecular formula C7H7FS
and a molecular weight of 142.20 g/mol. Its IUPAC name is 4-fluorocyclohexa-1,5-diene-1-carbothialdehyde.
Molecular Properties
| Compound Name | 4-fluorocyclohexa-1,5-diene-1-carbothialdehyde |
| PubChem CID | 89330132 |
| Molecular Formula | C7H7FS |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | 4-fluorocyclohexa-1,5-diene-1-carbothialdehyde |
| SMILES | FC1C=CC(C=S)=CC1 |
| InChI | InChI=1S/C7H7FS/c8-7-3-1-6(5-9)2-4-7/h1-3,5,7H,4H2 |
| InChIKey | PGUZYILLOJTHQP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-fluorocyclohexa-1,5-diene-1-carbothialdehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorocyclohexa-1,5-diene-1-carbothialdehyde?
The IUPAC name of 4-fluorocyclohexa-1,5-diene-1-carbothialdehyde (CID 89330132) is 4-fluorocyclohexa-1,5-diene-1-carbothialdehyde.
What is the SMILES notation for 4-fluorocyclohexa-1,5-diene-1-carbothialdehyde?
The canonical SMILES for 4-fluorocyclohexa-1,5-diene-1-carbothialdehyde is FC1C=CC(C=S)=CC1.
What is the InChIKey of 4-fluorocyclohexa-1,5-diene-1-carbothialdehyde?
The InChIKey is PGUZYILLOJTHQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FS/c8-7-3-1-6(5-9)2-4-7/h1-3,5,7H,4H2.
What are the key properties of 4-fluorocyclohexa-1,5-diene-1-carbothialdehyde?
4-fluorocyclohexa-1,5-diene-1-carbothialdehyde has a molecular weight of 142.20 g/mol, XLogP of 2.21, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorocyclohexa-1,5-diene-1-carbothialdehyde is sourced from PubChem (CID 89330132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).