C18H16F7N5O — CID 89330162
N'-amino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-(2,2,2-trifluoroethyl)-2-pyridinyl]propyl]-N-(methylideneamino)methanimidamide (PubChem CID 89330162) has the molecular formula C18H16F7N5O and a molecular weight of 451.35 g/mol. Its IUPAC name is N'-amino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-(2,2,2-trifluoroethyl)-2-pyridinyl]propyl]-N-(methylideneamino)methanimidamide.
| Compound Name | N'-amino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-(2,2,2-trifluoroethyl)-2-pyridinyl]propyl]-N-(methylideneamino)methanimidamide |
|---|---|
| PubChem CID | 89330162 |
| Molecular Formula | C18H16F7N5O |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | N'-amino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-(2,2,2-trifluoroethyl)-2-pyridinyl]propyl]-N-(methylideneamino)methanimidamide |
| SMILES | C=NN(/C=N\N)CC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(CC(F)(F)F)cn1 |
| InChI | InChI=1S/C18H16F7N5O/c1-27-30(10-29-26)9-16(31,13-4-3-12(19)6-14(13)20)18(24,25)15-5-2-11(8-28-15)7-17(21,22)23/h2-6,8,10,31H,1,7,9,26H2/b29-10- |
| InChIKey | PDGFWDDZXKSBCK-DANHRZQXSA-N |
| XLogP | 3.26 |
| TPSA | 87.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|