C21H17ClF4N6O — CID 89330179
1-[5-[(3Z,5E)-6-amino-5-chlorohexa-1,3,5-trien-2-yl]-2-pyridinyl]-2-(2,4-difluorophenyl)-1,1-difluoro-3-(tetrazol-1-yl)propan-2-ol (PubChem CID 89330179) has the molecular formula C21H17ClF4N6O and a molecular weight of 480.85 g/mol. Its IUPAC name is 1-[5-[(3Z,5E)-6-amino-5-chlorohexa-1,3,5-trien-2-yl]-2-pyridinyl]-2-(2,4-difluorophenyl)-1,1-difluoro-3-(tetrazol-1-yl)propan-2-ol.
| Compound Name | 1-[5-[(3Z,5E)-6-amino-5-chlorohexa-1,3,5-trien-2-yl]-2-pyridinyl]-2-(2,4-difluorophenyl)-1,1-difluoro-3-(tetrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 89330179 |
| Molecular Formula | C21H17ClF4N6O |
| Molecular Weight | 480.85 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 1-[5-[(3Z,5E)-6-amino-5-chlorohexa-1,3,5-trien-2-yl]-2-pyridinyl]-2-(2,4-difluorophenyl)-1,1-difluoro-3-(tetrazol-1-yl)propan-2-ol |
| SMILES | C=C(/C=C\C(Cl)=C/N)c1ccc(C(F)(F)C(O)(Cn2cnnn2)c2ccc(F)cc2F)nc1 |
| InChI | InChI=1S/C21H17ClF4N6O/c1-13(2-4-15(22)9-27)14-3-7-19(28-10-14)21(25,26)20(33,11-32-12-29-30-31-32)17-6-5-16(23)8-18(17)24/h2-10,12,33H,1,11,27H2/b4-2-,15-9+ |
| InChIKey | FHPODJWIWIKCGD-WTDLEKSJSA-N |
| XLogP | 3.63 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.85 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|