C21H25F4N5O2 — CID 89330193
N'-amino-N-[2-(2,4-difluorophenyl)-3-[5-(3-ethoxypropyl)-2-pyridinyl]-3,3-difluoro-2-hydroxypropyl]-N-(methylideneamino)methanimidamide (PubChem CID 89330193) has the molecular formula C21H25F4N5O2 and a molecular weight of 455.46 g/mol. Its IUPAC name is N'-amino-N-[2-(2,4-difluorophenyl)-3-[5-(3-ethoxypropyl)-2-pyridinyl]-3,3-difluoro-2-hydroxypropyl]-N-(methylideneamino)methanimidamide.
| Compound Name | N'-amino-N-[2-(2,4-difluorophenyl)-3-[5-(3-ethoxypropyl)-2-pyridinyl]-3,3-difluoro-2-hydroxypropyl]-N-(methylideneamino)methanimidamide |
|---|---|
| PubChem CID | 89330193 |
| Molecular Formula | C21H25F4N5O2 |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | N'-amino-N-[2-(2,4-difluorophenyl)-3-[5-(3-ethoxypropyl)-2-pyridinyl]-3,3-difluoro-2-hydroxypropyl]-N-(methylideneamino)methanimidamide |
| SMILES | C=NN(/C=N\N)CC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(CCCOCC)cn1 |
| InChI | InChI=1S/C21H25F4N5O2/c1-3-32-10-4-5-15-6-9-19(28-12-15)21(24,25)20(31,13-30(27-2)14-29-26)17-8-7-16(22)11-18(17)23/h6-9,11-12,14,31H,2-5,10,13,26H2,1H3/b29-14- |
| InChIKey | SLWXLXGKLOKRCC-NUJZUDFISA-N |
| XLogP | 3.13 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|