C24H34O2 — CID 89330333
(5E,7E,9E,11E,13E,15E)-17-ethoxy-5,9,14,16-tetramethyloctadeca-5,7,9,11,13,15,17-heptaen-4-one (PubChem CID 89330333) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is (5E,7E,9E,11E,13E,15E)-17-ethoxy-5,9,14,16-tetramethyloctadeca-5,7,9,11,13,15,17-heptaen-4-one.
| Compound Name | (5E,7E,9E,11E,13E,15E)-17-ethoxy-5,9,14,16-tetramethyloctadeca-5,7,9,11,13,15,17-heptaen-4-one |
|---|---|
| PubChem CID | 89330333 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (5E,7E,9E,11E,13E,15E)-17-ethoxy-5,9,14,16-tetramethyloctadeca-5,7,9,11,13,15,17-heptaen-4-one |
| SMILES | C=C(OCC)/C(C)=C/C(C)=C/C=C/C=C(C)/C=C/C=C(\C)C(=O)CCC |
| InChI | InChI=1S/C24H34O2/c1-8-13-24(25)21(5)17-12-16-19(3)14-10-11-15-20(4)18-22(6)23(7)26-9-2/h10-12,14-18H,7-9,13H2,1-6H3/b11-10+,16-12+,19-14+,20-15+,21-17+,22-18+ |
| InChIKey | TUGHAARRGBIDMQ-JBGVPPHESA-N |
| XLogP | 6.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|