C32H44O2 — CID 89330334
(5E,7E,9E,11E,13E,15E,17E,19E,21E)-23-ethoxy-5,7,11,16,20,22-hexamethyltetracosa-5,7,9,11,13,15,17,19,21,23-decaen-4-one (PubChem CID 89330334) has the molecular formula C32H44O2 and a molecular weight of 460.70 g/mol. Its IUPAC name is (5E,7E,9E,11E,13E,15E,17E,19E,21E)-23-ethoxy-5,7,11,16,20,22-hexamethyltetracosa-5,7,9,11,13,15,17,19,21,23-decaen-4-one.
| Compound Name | (5E,7E,9E,11E,13E,15E,17E,19E,21E)-23-ethoxy-5,7,11,16,20,22-hexamethyltetracosa-5,7,9,11,13,15,17,19,21,23-decaen-4-one |
|---|---|
| PubChem CID | 89330334 |
| Molecular Formula | C32H44O2 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.33 |
| IUPAC Name | (5E,7E,9E,11E,13E,15E,17E,19E,21E)-23-ethoxy-5,7,11,16,20,22-hexamethyltetracosa-5,7,9,11,13,15,17,19,21,23-decaen-4-one |
| SMILES | C=C(OCC)/C(C)=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C(\C)C(=O)CCC |
| InChI | InChI=1S/C32H44O2/c1-10-16-32(33)30(8)24-28(6)22-15-20-26(4)18-13-12-17-25(3)19-14-21-27(5)23-29(7)31(9)34-11-2/h12-15,17-24H,9-11,16H2,1-8H3/b13-12+,19-14+,20-15+,25-17+,26-18+,27-21+,28-22+,29-23+,30-24+ |
| InChIKey | FSTGQXOBSFQACB-CBMAETBLSA-N |
| XLogP | 9.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|