About 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-iodopropan-2-one
1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-iodopropan-2-one (PubChem CID 89330649) has the molecular formula C10H13IO2
and a molecular weight of 292.12 g/mol. Its IUPAC name is 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-iodopropan-2-one.
Molecular Properties
| Compound Name | 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-iodopropan-2-one |
| PubChem CID | 89330649 |
| Molecular Formula | C10H13IO2 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-iodopropan-2-one |
| SMILES | O=C(CI)COCC1=CCCC=C1 |
| InChI | InChI=1S/C10H13IO2/c11-6-10(12)8-13-7-9-4-2-1-3-5-9/h2,4-5H,1,3,6-8H2 |
| InChIKey | FYARBFKYDHFRQW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-iodopropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-iodopropan-2-one?
The IUPAC name of 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-iodopropan-2-one (CID 89330649) is 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-iodopropan-2-one.
What is the SMILES notation for 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-iodopropan-2-one?
The canonical SMILES for 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-iodopropan-2-one is O=C(CI)COCC1=CCCC=C1.
What is the InChIKey of 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-iodopropan-2-one?
The InChIKey is FYARBFKYDHFRQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13IO2/c11-6-10(12)8-13-7-9-4-2-1-3-5-9/h2,4-5H,1,3,6-8H2.
What are the key properties of 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-iodopropan-2-one?
1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-iodopropan-2-one has a molecular weight of 292.12 g/mol, XLogP of 2.28, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-iodopropan-2-one is sourced from PubChem (CID 89330649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).