C11H14N2 — CID 89330901
(1R)-N,6-dimethylcyclohepta-2,4-diene-1-carboximidoyl cyanide (PubChem CID 89330901) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is (1R)-N,6-dimethylcyclohepta-2,4-diene-1-carboximidoyl cyanide.
| Compound Name | (1R)-N,6-dimethylcyclohepta-2,4-diene-1-carboximidoyl cyanide |
|---|---|
| PubChem CID | 89330901 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (1R)-N,6-dimethylcyclohepta-2,4-diene-1-carboximidoyl cyanide |
| SMILES | C/N=C(\C#N)[C@H]1C=CC=CC(C)C1 |
| InChI | InChI=1S/C11H14N2/c1-9-5-3-4-6-10(7-9)11(8-12)13-2/h3-6,9-10H,7H2,1-2H3/b13-11+/t9?,10-/m0/s1 |
| InChIKey | WSMVFZBMOIODTG-KDHDJBLNSA-N |
| XLogP | 2.35 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|