C26H20F3N5O2 — CID 89331063
(2E,4Z)-2-ethenyl-N-[4-[5-(5-pyrimidin-5-ylfuran-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]hexa-2,4-dienamide (PubChem CID 89331063) has the molecular formula C26H20F3N5O2 and a molecular weight of 491.47 g/mol. Its IUPAC name is (2E,4Z)-2-ethenyl-N-[4-[5-(5-pyrimidin-5-ylfuran-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]hexa-2,4-dienamide.
| Compound Name | (2E,4Z)-2-ethenyl-N-[4-[5-(5-pyrimidin-5-ylfuran-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 89331063 |
| Molecular Formula | C26H20F3N5O2 |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | (2E,4Z)-2-ethenyl-N-[4-[5-(5-pyrimidin-5-ylfuran-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]hexa-2,4-dienamide |
| SMILES | C=C/C(=C\C=C/C)C(=O)Nc1ccc(-n2nc(C(F)(F)F)cc2-c2ccc(-c3cncnc3)o2)cc1 |
| InChI | InChI=1S/C26H20F3N5O2/c1-3-5-6-17(4-2)25(35)32-19-7-9-20(10-8-19)34-21(13-24(33-34)26(27,28)29)23-12-11-22(36-23)18-14-30-16-31-15-18/h3-16H,2H2,1H3,(H,32,35)/b5-3-,17-6+ |
| InChIKey | GPGSLXHRLUYGGG-UCHPOWPESA-N |
| XLogP | 6.24 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|