C19H20N4O — CID 893311
3-(1,2-dimethylbenzimidazol-5-yl)-1-phenyl-1-prop-2-enylurea (PubChem CID 893311) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is 3-(1,2-dimethylbenzimidazol-5-yl)-1-phenyl-1-prop-2-enylurea.
| Compound Name | 3-(1,2-dimethylbenzimidazol-5-yl)-1-phenyl-1-prop-2-enylurea |
|---|---|
| PubChem CID | 893311 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 3-(1,2-dimethylbenzimidazol-5-yl)-1-phenyl-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)Nc1ccc2c(c1)nc(C)n2C)c1ccccc1 |
| InChI | InChI=1S/C19H20N4O/c1-4-12-23(16-8-6-5-7-9-16)19(24)21-15-10-11-18-17(13-15)20-14(2)22(18)3/h4-11,13H,1,12H2,2-3H3,(H,21,24) |
| InChIKey | JQJPQKOORJUPQE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|