C21H34O5 — CID 89331189
(2R,3S,4R,7R,14R)-6-hydroxy-3-(methoxymethoxy)-2,4,7,14-tetramethyl-9-oxotricyclo[5.4.3.01,8]tetradecane-4-carbaldehyde (PubChem CID 89331189) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is (2R,3S,4R,7R,14R)-6-hydroxy-3-(methoxymethoxy)-2,4,7,14-tetramethyl-9-oxotricyclo[5.4.3.01,8]tetradecane-4-carbaldehyde.
| Compound Name | (2R,3S,4R,7R,14R)-6-hydroxy-3-(methoxymethoxy)-2,4,7,14-tetramethyl-9-oxotricyclo[5.4.3.01,8]tetradecane-4-carbaldehyde |
|---|---|
| PubChem CID | 89331189 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | (2R,3S,4R,7R,14R)-6-hydroxy-3-(methoxymethoxy)-2,4,7,14-tetramethyl-9-oxotricyclo[5.4.3.01,8]tetradecane-4-carbaldehyde |
| SMILES | COCO[C@H]1[C@H](C)C23CCC(=O)C2[C@](C)(C(O)C[C@@]1(C)C=O)[C@H](C)CC3 |
| InChI | InChI=1S/C21H34O5/c1-13-6-8-21-9-7-15(23)17(21)20(13,4)16(24)10-19(3,11-22)18(14(21)2)26-12-25-5/h11,13-14,16-18,24H,6-10,12H2,1-5H3/t13-,14+,16?,17?,18+,19+,20+,21?/m1/s1 |
| InChIKey | JERZHOLXCCMTGQ-RUHXRPNUSA-N |
| XLogP | 2.98 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|