C15H18F6O5 — CID 89331228
[2-(1-ethoxyethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl] 7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 89331228) has the molecular formula C15H18F6O5 and a molecular weight of 392.29 g/mol. Its IUPAC name is [2-(1-ethoxyethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl] 7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [2-(1-ethoxyethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl] 7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 89331228 |
| Molecular Formula | C15H18F6O5 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [2-(1-ethoxyethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl] 7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(C)OC(COC(=O)C1CC2C=CC1O2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H18F6O5/c1-3-23-8(2)26-13(14(16,17)18,15(19,20)21)7-24-12(22)10-6-9-4-5-11(10)25-9/h4-5,8-11H,3,6-7H2,1-2H3 |
| InChIKey | PWUNERGLOFETNB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|