About 4-methoxy-6-prop-2-enoxy-1H-1,3,5-triazin-2-one
4-methoxy-6-prop-2-enoxy-1H-1,3,5-triazin-2-one (PubChem CID 89331249) has the molecular formula C7H9N3O3
and a molecular weight of 183.17 g/mol. Its IUPAC name is 4-methoxy-6-prop-2-enoxy-1H-1,3,5-triazin-2-one.
Molecular Properties
| Compound Name | 4-methoxy-6-prop-2-enoxy-1H-1,3,5-triazin-2-one |
| PubChem CID | 89331249 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 4-methoxy-6-prop-2-enoxy-1H-1,3,5-triazin-2-one |
| SMILES | C=CCOc1nc(OC)nc(=O)[nH]1 |
| InChI | InChI=1S/C7H9N3O3/c1-3-4-13-7-9-5(11)8-6(10-7)12-2/h3H,1,4H2,2H3,(H,8,9,10,11) |
| InChIKey | IOCLXGYNVTXEDF-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-6-prop-2-enoxy-1H-1,3,5-triazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-6-prop-2-enoxy-1H-1,3,5-triazin-2-one?
The IUPAC name of 4-methoxy-6-prop-2-enoxy-1H-1,3,5-triazin-2-one (CID 89331249) is 4-methoxy-6-prop-2-enoxy-1H-1,3,5-triazin-2-one.
What is the SMILES notation for 4-methoxy-6-prop-2-enoxy-1H-1,3,5-triazin-2-one?
The canonical SMILES for 4-methoxy-6-prop-2-enoxy-1H-1,3,5-triazin-2-one is C=CCOc1nc(OC)nc(=O)[nH]1.
What is the InChIKey of 4-methoxy-6-prop-2-enoxy-1H-1,3,5-triazin-2-one?
The InChIKey is IOCLXGYNVTXEDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O3/c1-3-4-13-7-9-5(11)8-6(10-7)12-2/h3H,1,4H2,2H3,(H,8,9,10,11).
What are the key properties of 4-methoxy-6-prop-2-enoxy-1H-1,3,5-triazin-2-one?
4-methoxy-6-prop-2-enoxy-1H-1,3,5-triazin-2-one has a molecular weight of 183.17 g/mol, XLogP of -0.26, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-6-prop-2-enoxy-1H-1,3,5-triazin-2-one is sourced from PubChem (CID 89331249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).