About 2-[[4-(6-nitro-3-pyridinyl)piperazin-1-ium-1-yl]methyl]-1,3-benzothiazole
2-[[4-(6-nitro-3-pyridinyl)piperazin-1-ium-1-yl]methyl]-1,3-benzothiazole (PubChem CID 8933129) has the molecular formula C17H18N5O2S+
and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-[[4-(6-nitro-3-pyridinyl)piperazin-1-ium-1-yl]methyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[[4-(6-nitro-3-pyridinyl)piperazin-1-ium-1-yl]methyl]-1,3-benzothiazole |
| PubChem CID | 8933129 |
| Molecular Formula | C17H18N5O2S+ |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-[[4-(6-nitro-3-pyridinyl)piperazin-1-ium-1-yl]methyl]-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc(N2CC[NH+](Cc3nc4ccccc4s3)CC2)cn1 |
| InChI | InChI=1S/C17H17N5O2S/c23-22(24)16-6-5-13(11-18-16)21-9-7-20(8-10-21)12-17-19-14-3-1-2-4-15(14)25-17/h1-6,11H,7-10,12H2/p+1 |
| InChIKey | OZABYZOSCZHHBI-UHFFFAOYSA-O |
| XLogP | 1.50 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(6-nitro-3-pyridinyl)piperazin-1-ium-1-yl]methyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(6-nitro-3-pyridinyl)piperazin-1-ium-1-yl]methyl]-1,3-benzothiazole?
The IUPAC name of 2-[[4-(6-nitro-3-pyridinyl)piperazin-1-ium-1-yl]methyl]-1,3-benzothiazole (CID 8933129) is 2-[[4-(6-nitro-3-pyridinyl)piperazin-1-ium-1-yl]methyl]-1,3-benzothiazole.
What is the SMILES notation for 2-[[4-(6-nitro-3-pyridinyl)piperazin-1-ium-1-yl]methyl]-1,3-benzothiazole?
The canonical SMILES for 2-[[4-(6-nitro-3-pyridinyl)piperazin-1-ium-1-yl]methyl]-1,3-benzothiazole is O=[N+]([O-])c1ccc(N2CC[NH+](Cc3nc4ccccc4s3)CC2)cn1.
What is the InChIKey of 2-[[4-(6-nitro-3-pyridinyl)piperazin-1-ium-1-yl]methyl]-1,3-benzothiazole?
The InChIKey is OZABYZOSCZHHBI-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H17N5O2S/c23-22(24)16-6-5-13(11-18-16)21-9-7-20(8-10-21)12-17-19-14-3-1-2-4-15(14)25-17/h1-6,11H,7-10,12H2/p+1.
What are the key properties of 2-[[4-(6-nitro-3-pyridinyl)piperazin-1-ium-1-yl]methyl]-1,3-benzothiazole?
2-[[4-(6-nitro-3-pyridinyl)piperazin-1-ium-1-yl]methyl]-1,3-benzothiazole has a molecular weight of 356.43 g/mol, XLogP of 1.50, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(6-nitro-3-pyridinyl)piperazin-1-ium-1-yl]methyl]-1,3-benzothiazole is sourced from PubChem (CID 8933129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).