About (E)-1-cyclohexa-1,5-dien-1-yl-N-methoxyethanimine
(E)-1-cyclohexa-1,5-dien-1-yl-N-methoxyethanimine (PubChem CID 89331310) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is (E)-1-cyclohexa-1,5-dien-1-yl-N-methoxyethanimine.
Molecular Properties
| Compound Name | (E)-1-cyclohexa-1,5-dien-1-yl-N-methoxyethanimine |
| PubChem CID | 89331310 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (E)-1-cyclohexa-1,5-dien-1-yl-N-methoxyethanimine |
| SMILES | CO/N=C(\C)C1=CCCC=C1 |
| InChI | InChI=1S/C9H13NO/c1-8(10-11-2)9-6-4-3-5-7-9/h4,6-7H,3,5H2,1-2H3/b10-8+ |
| InChIKey | XJNRANQJZCGZLL-CSKARUKUSA-N |
| XLogP | 2.29 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-cyclohexa-1,5-dien-1-yl-N-methoxyethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-cyclohexa-1,5-dien-1-yl-N-methoxyethanimine?
The IUPAC name of (E)-1-cyclohexa-1,5-dien-1-yl-N-methoxyethanimine (CID 89331310) is (E)-1-cyclohexa-1,5-dien-1-yl-N-methoxyethanimine.
What is the SMILES notation for (E)-1-cyclohexa-1,5-dien-1-yl-N-methoxyethanimine?
The canonical SMILES for (E)-1-cyclohexa-1,5-dien-1-yl-N-methoxyethanimine is CO/N=C(\C)C1=CCCC=C1.
What is the InChIKey of (E)-1-cyclohexa-1,5-dien-1-yl-N-methoxyethanimine?
The InChIKey is XJNRANQJZCGZLL-CSKARUKUSA-N. The full InChI is InChI=1S/C9H13NO/c1-8(10-11-2)9-6-4-3-5-7-9/h4,6-7H,3,5H2,1-2H3/b10-8+.
What are the key properties of (E)-1-cyclohexa-1,5-dien-1-yl-N-methoxyethanimine?
(E)-1-cyclohexa-1,5-dien-1-yl-N-methoxyethanimine has a molecular weight of 151.21 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-cyclohexa-1,5-dien-1-yl-N-methoxyethanimine is sourced from PubChem (CID 89331310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).