About 3-[2-[(1R)-cyclohex-2-en-1-yl]but-3-enyl]-2,3-dihydro-1H-pyrrole
3-[2-[(1R)-cyclohex-2-en-1-yl]but-3-enyl]-2,3-dihydro-1H-pyrrole (PubChem CID 89331378) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is 3-[2-[(1R)-cyclohex-2-en-1-yl]but-3-enyl]-2,3-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | 3-[2-[(1R)-cyclohex-2-en-1-yl]but-3-enyl]-2,3-dihydro-1H-pyrrole |
| PubChem CID | 89331378 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 3-[2-[(1R)-cyclohex-2-en-1-yl]but-3-enyl]-2,3-dihydro-1H-pyrrole |
| SMILES | C=CC(CC1C=CNC1)[C@H]1C=CCCC1 |
| InChI | InChI=1S/C14H21N/c1-2-13(10-12-8-9-15-11-12)14-6-4-3-5-7-14/h2,4,6,8-9,12-15H,1,3,5,7,10-11H2/t12?,13?,14-/m0/s1 |
| InChIKey | QHHHIKCRVNJDJV-RUXDESIVSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[(1R)-cyclohex-2-en-1-yl]but-3-enyl]-2,3-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(1R)-cyclohex-2-en-1-yl]but-3-enyl]-2,3-dihydro-1H-pyrrole?
The IUPAC name of 3-[2-[(1R)-cyclohex-2-en-1-yl]but-3-enyl]-2,3-dihydro-1H-pyrrole (CID 89331378) is 3-[2-[(1R)-cyclohex-2-en-1-yl]but-3-enyl]-2,3-dihydro-1H-pyrrole.
What is the SMILES notation for 3-[2-[(1R)-cyclohex-2-en-1-yl]but-3-enyl]-2,3-dihydro-1H-pyrrole?
The canonical SMILES for 3-[2-[(1R)-cyclohex-2-en-1-yl]but-3-enyl]-2,3-dihydro-1H-pyrrole is C=CC(CC1C=CNC1)[C@H]1C=CCCC1.
What is the InChIKey of 3-[2-[(1R)-cyclohex-2-en-1-yl]but-3-enyl]-2,3-dihydro-1H-pyrrole?
The InChIKey is QHHHIKCRVNJDJV-RUXDESIVSA-N. The full InChI is InChI=1S/C14H21N/c1-2-13(10-12-8-9-15-11-12)14-6-4-3-5-7-14/h2,4,6,8-9,12-15H,1,3,5,7,10-11H2/t12?,13?,14-/m0/s1.
What are the key properties of 3-[2-[(1R)-cyclohex-2-en-1-yl]but-3-enyl]-2,3-dihydro-1H-pyrrole?
3-[2-[(1R)-cyclohex-2-en-1-yl]but-3-enyl]-2,3-dihydro-1H-pyrrole has a molecular weight of 203.33 g/mol, XLogP of 3.27, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(1R)-cyclohex-2-en-1-yl]but-3-enyl]-2,3-dihydro-1H-pyrrole is sourced from PubChem (CID 89331378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).